/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Free solutions & answers for Organic Chemistry Chapter 8 - (Page 1) [step by step] | ÷ÈÓ°Ö±²¥

÷ÈÓ°Ö±²¥

Problem 1

Label the \(\alpha\) and \(\beta\) carbons in each alkyl halide, and draw all possible elimination products in each reaction. a. \(\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2}-\mathrm{Cl} \quad \stackrel{\mathrm{K}^{+}-\mathrm{OC}\left(\mathrm{CH}_{3}\right)_{3}}{\longrightarrow}\) c. CCC(Cl)CC CO b. CCCCC(C)Br d. CC1(Br)CCCCC1 \(\mathrm{K}^{+-\mathrm{OH}}\)

Problem 2

Classify each alkene in the following vitamins by the number of carbon substituents bonded to the double bond. a. CC(C=CC=CC(C)=CC1=C(C)CCCC1(C)C)=CCO b.

Problem 3

For which alkenes are stereoisomers possible? a. CCCC=C(C)C c. \(\mathrm{CH}_{2}=\mathrm{CHCH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{3}\) b. \(\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}=\mathrm{CHCH}_{3}\) d. C=CC1CCCCC1

Problem 6

Several factors can affect alkene stability. Explain why alkene \(\mathrm{A}\) is more stable than alkene \(\mathrm{B}\) even though both contain disubstituted carbon-carbon double bonds. C1=CCC2CCC2C1 C1=CC2CCCCC2C1 B

Problem 10

Rank the alkyl halides in each group in order of increasing reactivity in an E2 reaction. a. \(\left(\mathrm{CH}_{3}\right)_{2} \mathrm{C}(\mathrm{Br}) \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{3}\) \(\left(\mathrm{CH}_{3}\right)_{2} \mathrm{CHCH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{Br}\) \(\left(\mathrm{CH}_{3}\right)_{2} \mathrm{CHCH}_{2} \mathrm{CH}(\mathrm{Br}) \mathrm{CH}_{3}\) b. ClCCC1CCCCC1 CC1(Cl)CCCCC1 CC1CCCC(Cl)C1

Problem 11

How does each of the following changes affect the rate of an E2 reaction? a. tripling [RX] d. changing the leaving group from \(\mathrm{I}^{-}\) to \(\mathrm{Br}^{-}\) b. halving [B:] e. changing the base from \({ }^{-} \mathrm{OH}\) to \(\mathrm{H}_{2} \mathrm{O}\) c. changing the solvent from \(\mathrm{CH}_{3} \mathrm{OH}\) to DMSO f. changing the alkyl halide from \(\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{Br}\) to \(\left(\mathrm{CH}_{3}\right)_{2} \mathrm{CHBr}\)

Problem 12

What alkenes are formed from each alkyl halide by an \(\mathrm{E} 2\) reaction? Use the Zaitsev rule to predict the major product. a. b. CC1CCCC1(C)Br c. CCCCCC(C)Cl d. CC1CCC(C)(C)C1Cl

Problem 13

Draw an E1 mechanism for the following reaction. Draw the structure of the transition state for each step. $$ \left(\mathrm{CH}_{3}\right)_{2} \mathrm{C}(\mathrm{Cl}) \mathrm{CH}_{2} \mathrm{CH}_{3}+\mathrm{CH}_{3} \mathrm{OH} \quad \longrightarrow \quad\left(\mathrm{CH}_{3}\right)_{2} \mathrm{C}=\mathrm{CHCH}_{3}+\mathrm{CH}_{3} \mathrm{OH}_{2}+\mathrm{Cl}^{-} $$

Problem 14

What alkenes are formed from each alkyl halide by an \(\mathrm{E} 1\) reaction? Use the Zaitsev rule to predict the major product. a. CCC(C)(C)Cl b. CCCC1CCCC1C

Problem 15

How does each of the following changes affect the rate of an E1 reaction? a. doubling [RX] d. changing the leaving group from \(\mathrm{Cl}^{-}\) to \(\mathrm{Br}\) b. doubling [B:] e. changing the solvent from DMSO to \(\mathrm{CH}_{3} \mathrm{OH}\) c. changing the halide from \(\left(\mathrm{CH}_{3}\right)_{3} \mathrm{CBr}\) to \(\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{Br}\)

Access millions of textbook solutions in one place

  • Access over 3 million high quality textbook solutions
  • Access our popular flashcard, quiz, mock-exam and notes features
  • Access our smart AI features to upgrade your learning
Access millions of textbook solutions in one place

Recommended explanations on Chemistry Textbooks